C11H13N3O3 — CID 115168250
1-methyl-1-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea (PubChem CID 115168250) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1-methyl-1-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea.
| Compound Name | 1-methyl-1-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea |
|---|---|
| PubChem CID | 115168250 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-methyl-1-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea |
| SMILES | CC1Oc2ccc(N(C)C(N)=O)cc2NC1=O |
| InChI | InChI=1S/C11H13N3O3/c1-6-10(15)13-8-5-7(14(2)11(12)16)3-4-9(8)17-6/h3-6H,1-2H3,(H2,12,16)(H,13,15) |
| InChIKey | CZAKZMFXYGCFFK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |