C13H16N2O3 — CID 116940571
6-(1-amino-3-oxobutyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 116940571) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 6-(1-amino-3-oxobutyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-amino-3-oxobutyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116940571 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-(1-amino-3-oxobutyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)CC(N)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C13H16N2O3/c1-7(16)5-10(14)9-3-4-12-11(6-9)15-13(17)8(2)18-12/h3-4,6,8,10H,5,14H2,1-2H3,(H,15,17) |
| InChIKey | ZOFDXFAFOWRPEL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |