C12H16N2O3 — CID 116909591
6-[dimethylamino(hydroxy)methyl]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 116909591) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-[dimethylamino(hydroxy)methyl]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[dimethylamino(hydroxy)methyl]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116909591 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 6-[dimethylamino(hydroxy)methyl]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(O)N(C)C)cc2NC1=O |
| InChI | InChI=1S/C12H16N2O3/c1-7-11(15)13-9-6-8(12(16)14(2)3)4-5-10(9)17-7/h4-7,12,16H,1-3H3,(H,13,15) |
| InChIKey | LISDXOAPFZTINR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|