C12H15NO3 — CID 22623043
6-(1-hydroxypropyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 22623043) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-(1-hydroxypropyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-hydroxypropyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22623043 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 6-(1-hydroxypropyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCC(O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C12H15NO3/c1-3-10(14)8-4-5-11-9(6-8)13-12(15)7(2)16-11/h4-7,10,14H,3H2,1-2H3,(H,13,15) |
| InChIKey | WQNHYDLEADMYAG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |