C12H10F3NO3 — CID 43340891
2-methyl-6-(3,3,3-trifluoropropanoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 43340891) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-methyl-6-(3,3,3-trifluoropropanoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-(3,3,3-trifluoropropanoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43340891 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-methyl-6-(3,3,3-trifluoropropanoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(=O)CC(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C12H10F3NO3/c1-6-11(18)16-8-4-7(2-3-10(8)19-6)9(17)5-12(13,14)15/h2-4,6H,5H2,1H3,(H,16,18) |
| InChIKey | YLQSAKVZVRJDFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |