C15H9Br2NO3 — CID 107949715
6-(2,4-dibromobenzoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 107949715) has the molecular formula C15H9Br2NO3 and a molecular weight of 411.05 g/mol. Its IUPAC name is 6-(2,4-dibromobenzoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,4-dibromobenzoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107949715 |
| Molecular Formula | C15H9Br2NO3 |
| Molecular Weight | 411.05 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | 6-(2,4-dibromobenzoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)c3ccc(Br)cc3Br)cc2N1 |
| InChI | InChI=1S/C15H9Br2NO3/c16-9-2-3-10(11(17)6-9)15(20)8-1-4-13-12(5-8)18-14(19)7-21-13/h1-6H,7H2,(H,18,19) |
| InChIKey | AXHGLHOWMCCGBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.05 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |