C15H13FN2O4S — CID 16615807
N-(2-fluoro-4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 16615807) has the molecular formula C15H13FN2O4S and a molecular weight of 336.34 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 16615807 |
| Molecular Formula | C15H13FN2O4S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)c(F)c1 |
| InChI | InChI=1S/C15H13FN2O4S/c1-9-2-4-12(11(16)6-9)18-23(20,21)10-3-5-14-13(7-10)17-15(19)8-22-14/h2-7,18H,8H2,1H3,(H,17,19) |
| InChIKey | JNAPYUDPPOCKPE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |