C14H9F3N2O4S — CID 18147171
3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 18147171) has the molecular formula C14H9F3N2O4S and a molecular weight of 358.30 g/mol. Its IUPAC name is 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 18147171 |
| Molecular Formula | C14H9F3N2O4S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | O=C1COc2ccc(S(=O)(=O)Nc3ccc(F)c(F)c3F)cc2N1 |
| InChI | InChI=1S/C14H9F3N2O4S/c15-8-2-3-9(14(17)13(8)16)19-24(21,22)7-1-4-11-10(5-7)18-12(20)6-23-11/h1-5,19H,6H2,(H,18,20) |
| InChIKey | HVFPMYZQIYTAFB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|