C6H5N3O2 — CID 118023009
5H-pyridazino[3,4-b][1,4]oxazin-6-one (PubChem CID 118023009) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is 5H-pyridazino[3,4-b][1,4]oxazin-6-one.
| Compound Name | 5H-pyridazino[3,4-b][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 118023009 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 5H-pyridazino[3,4-b][1,4]oxazin-6-one |
| SMILES | O=C1COc2nnccc2N1 |
| InChI | InChI=1S/C6H5N3O2/c10-5-3-11-6-4(8-5)1-2-7-9-6/h1-2H,3H2,(H,8,10) |
| InChIKey | SRHCRLTWJGTNEO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |