C17H13N3O2 — CID 22631411
7-(4-aminonaphthalen-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2-one (PubChem CID 22631411) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 7-(4-aminonaphthalen-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2-one.
| Compound Name | 7-(4-aminonaphthalen-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 22631411 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 7-(4-aminonaphthalen-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| SMILES | Nc1ccc(-c2cnc3c(c2)NC(=O)CO3)c2ccccc12 |
| InChI | InChI=1S/C17H13N3O2/c18-14-6-5-11(12-3-1-2-4-13(12)14)10-7-15-17(19-8-10)22-9-16(21)20-15/h1-8H,9,18H2,(H,20,21) |
| InChIKey | JBTRFKDNDWPCHD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|