C22H15N3O3 — CID 1472682
6-(4-oxo-3-phenylphthalazin-1-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 1472682) has the molecular formula C22H15N3O3 and a molecular weight of 369.38 g/mol. Its IUPAC name is 6-(4-oxo-3-phenylphthalazin-1-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-oxo-3-phenylphthalazin-1-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 1472682 |
| Molecular Formula | C22H15N3O3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 6-(4-oxo-3-phenylphthalazin-1-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3nn(-c4ccccc4)c(=O)c4ccccc34)cc2N1 |
| InChI | InChI=1S/C22H15N3O3/c26-20-13-28-19-11-10-14(12-18(19)23-20)21-16-8-4-5-9-17(16)22(27)25(24-21)15-6-2-1-3-7-15/h1-12H,13H2,(H,23,26) |
| InChIKey | SFJJHHSOHZKOCL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |