C24H19N3O2 — CID 56641349
6-[1-(2-methylphenyl)-4-phenylpyrazol-3-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 56641349) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-[1-(2-methylphenyl)-4-phenylpyrazol-3-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(2-methylphenyl)-4-phenylpyrazol-3-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 56641349 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6-[1-(2-methylphenyl)-4-phenylpyrazol-3-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccccc1-n1cc(-c2ccccc2)c(-c2ccc3c(c2)NC(=O)CO3)n1 |
| InChI | InChI=1S/C24H19N3O2/c1-16-7-5-6-10-21(16)27-14-19(17-8-3-2-4-9-17)24(26-27)18-11-12-22-20(13-18)25-23(28)15-29-22/h2-14H,15H2,1H3,(H,25,28) |
| InChIKey | MEQAHLHAIYIMIL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |