C17H13N3O3 — CID 1472754
6-(3-methyl-4-oxophthalazin-1-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 1472754) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 6-(3-methyl-4-oxophthalazin-1-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-methyl-4-oxophthalazin-1-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 1472754 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 6-(3-methyl-4-oxophthalazin-1-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1nc(-c2ccc3c(c2)NC(=O)CO3)c2ccccc2c1=O |
| InChI | InChI=1S/C17H13N3O3/c1-20-17(22)12-5-3-2-4-11(12)16(19-20)10-6-7-14-13(8-10)18-15(21)9-23-14/h2-8H,9H2,1H3,(H,18,21) |
| InChIKey | ANEZWJXFLJJOCZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |