C16H11ClN4O2 — CID 10215193
6-[5-(3-chlorophenyl)-2H-triazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 10215193) has the molecular formula C16H11ClN4O2 and a molecular weight of 326.74 g/mol. Its IUPAC name is 6-[5-(3-chlorophenyl)-2H-triazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[5-(3-chlorophenyl)-2H-triazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10215193 |
| Molecular Formula | C16H11ClN4O2 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 6-[5-(3-chlorophenyl)-2H-triazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3n[nH]nc3-c3cccc(Cl)c3)cc2N1 |
| InChI | InChI=1S/C16H11ClN4O2/c17-11-3-1-2-9(6-11)15-16(20-21-19-15)10-4-5-13-12(7-10)18-14(22)8-23-13/h1-7H,8H2,(H,18,22)(H,19,20,21) |
| InChIKey | SLSUNPWRTNPTFX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |