C23H17N3O2 — CID 56641613
6-(2,5-diphenyl-1H-imidazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 56641613) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-(2,5-diphenyl-1H-imidazol-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,5-diphenyl-1H-imidazol-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 56641613 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 6-(2,5-diphenyl-1H-imidazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3nc(-c4ccccc4)[nH]c3-c3ccccc3)cc2N1 |
| InChI | InChI=1S/C23H17N3O2/c27-20-14-28-19-12-11-17(13-18(19)24-20)22-21(15-7-3-1-4-8-15)25-23(26-22)16-9-5-2-6-10-16/h1-13H,14H2,(H,24,27)(H,25,26) |
| InChIKey | IXASVHSVVNKGHM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|