C19H16N3O2+ — CID 163690268
[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]-phenylazanium (PubChem CID 163690268) has the molecular formula C19H16N3O2+ and a molecular weight of 318.36 g/mol. Its IUPAC name is [4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]-phenylazanium.
| Compound Name | [4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]-phenylazanium |
|---|---|
| PubChem CID | 163690268 |
| Molecular Formula | C19H16N3O2+ |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]-phenylazanium |
| SMILES | O=C1COc2ccc(-c3ccnc([NH2+]c4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C19H15N3O2/c23-19-12-24-17-7-6-13(10-16(17)22-19)14-8-9-20-18(11-14)21-15-4-2-1-3-5-15/h1-11H,12H2,(H,20,21)(H,22,23)/p+1 |
| InChIKey | JSJUDQKGGOLFCE-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|