About 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide
3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide (PubChem CID 10430851) has the molecular formula C19H16N4O4S
and a molecular weight of 396.43 g/mol. Its IUPAC name is 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide |
| PubChem CID | 10430851 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2cc(-c3ccc4c(c3)NC(=O)CO4)ccn2)c1 |
| InChI | InChI=1S/C19H16N4O4S/c20-28(25,26)15-3-1-2-14(10-15)22-18-9-13(6-7-21-18)12-4-5-17-16(8-12)23-19(24)11-27-17/h1-10H,11H2,(H,21,22)(H,23,24)(H2,20,25,26) |
| InChIKey | WOAYABYSFYNKCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide?
The IUPAC name of 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide (CID 10430851) is 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide.
What is the SMILES notation for 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide?
The canonical SMILES for 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide is NS(=O)(=O)c1cccc(Nc2cc(-c3ccc4c(c3)NC(=O)CO4)ccn2)c1.
What is the InChIKey of 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide?
The InChIKey is WOAYABYSFYNKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O4S/c20-28(25,26)15-3-1-2-14(10-15)22-18-9-13(6-7-21-18)12-4-5-17-16(8-12)23-19(24)11-27-17/h1-10H,11H2,(H,21,22)(H,23,24)(H2,20,25,26).
What are the key properties of 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide?
3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide has a molecular weight of 396.43 g/mol, XLogP of 2.47, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]amino]benzenesulfonamide is sourced from PubChem (CID 10430851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).