C22H21N5O2S — CID 142168234
3-[[4-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-pyridinyl]amino]benzenesulfonamide (PubChem CID 142168234) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[[4-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-pyridinyl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-pyridinyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 142168234 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[[4-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-pyridinyl]amino]benzenesulfonamide |
| SMILES | Cc1ccc(-n2nc(C)cc2-c2ccnc(Nc3cccc(S(N)(=O)=O)c3)c2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-15-6-8-19(9-7-15)27-21(12-16(2)26-27)17-10-11-24-22(13-17)25-18-4-3-5-20(14-18)30(23,28)29/h3-14H,1-2H3,(H,24,25)(H2,23,28,29) |
| InChIKey | HJENNFXDPGLOEG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |