C18H17N5O4S — CID 118514047
3-[[4-(2-methyl-4-nitroanilino)-2-pyridinyl]amino]benzenesulfonamide (PubChem CID 118514047) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 3-[[4-(2-methyl-4-nitroanilino)-2-pyridinyl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(2-methyl-4-nitroanilino)-2-pyridinyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 118514047 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-[[4-(2-methyl-4-nitroanilino)-2-pyridinyl]amino]benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Nc1ccnc(Nc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C18H17N5O4S/c1-12-9-15(23(24)25)5-6-17(12)21-14-7-8-20-18(11-14)22-13-3-2-4-16(10-13)28(19,26)27/h2-11H,1H3,(H2,19,26,27)(H2,20,21,22) |
| InChIKey | VPYYRTDNIMEZOK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|