C13H13N5O3 — CID 62247149
4-hydrazinyl-N-(2-methyl-4-nitrophenyl)pyridine-2-carboxamide (PubChem CID 62247149) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2-methyl-4-nitrophenyl)pyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-(2-methyl-4-nitrophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62247149 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-hydrazinyl-N-(2-methyl-4-nitrophenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C13H13N5O3/c1-8-6-10(18(20)21)2-3-11(8)16-13(19)12-7-9(17-14)4-5-15-12/h2-7H,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | XARYNANWXMRVPR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|