C18H13FN4O2 — CID 10042614
6-[2-(4-fluoroanilino)pyrimidin-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 10042614) has the molecular formula C18H13FN4O2 and a molecular weight of 336.33 g/mol. Its IUPAC name is 6-[2-(4-fluoroanilino)pyrimidin-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-fluoroanilino)pyrimidin-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10042614 |
| Molecular Formula | C18H13FN4O2 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 6-[2-(4-fluoroanilino)pyrimidin-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3ccnc(Nc4ccc(F)cc4)n3)cc2N1 |
| InChI | InChI=1S/C18H13FN4O2/c19-12-2-4-13(5-3-12)21-18-20-8-7-14(23-18)11-1-6-16-15(9-11)22-17(24)10-25-16/h1-9H,10H2,(H,22,24)(H,20,21,23) |
| InChIKey | WLKJJVRCSAXELF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |