C18H15N5O4S — CID 10475912
3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 10475912) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 10475912 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-[[4-(3-oxo-4H-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2nccc(-c3ccc4c(c3)NC(=O)CO4)n2)c1 |
| InChI | InChI=1S/C18H15N5O4S/c19-28(25,26)13-3-1-2-12(9-13)21-18-20-7-6-14(23-18)11-4-5-16-15(8-11)22-17(24)10-27-16/h1-9H,10H2,(H,22,24)(H2,19,25,26)(H,20,21,23) |
| InChIKey | ULNYIKZLKOTZEE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |