About 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide
4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 10114338) has the molecular formula C23H17N5O3S
and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
| PubChem CID | 10114338 |
| Molecular Formula | C23H17N5O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nccc(-c3ccc4noc(-c5ccccc5)c4c3)n2)cc1 |
| InChI | InChI=1S/C23H17N5O3S/c24-32(29,30)18-9-7-17(8-10-18)26-23-25-13-12-20(27-23)16-6-11-21-19(14-16)22(31-28-21)15-4-2-1-3-5-15/h1-14H,(H2,24,29,30)(H,25,26,27) |
| InChIKey | MIQDHSOVALFWKS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The IUPAC name of 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide (CID 10114338) is 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide.
What is the SMILES notation for 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The canonical SMILES for 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide is NS(=O)(=O)c1ccc(Nc2nccc(-c3ccc4noc(-c5ccccc5)c4c3)n2)cc1.
What is the InChIKey of 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The InChIKey is MIQDHSOVALFWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N5O3S/c24-32(29,30)18-9-7-17(8-10-18)26-23-25-13-12-20(27-23)16-6-11-21-19(14-16)22(31-28-21)15-4-2-1-3-5-15/h1-14H,(H2,24,29,30)(H,25,26,27).
What are the key properties of 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide has a molecular weight of 443.49 g/mol, XLogP of 4.34, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(3-phenyl-2,1-benzoxazol-5-yl)pyrimidin-2-yl]amino]benzenesulfonamide is sourced from PubChem (CID 10114338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).