C20H15N5O4S — CID 17011425
5-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 17011425) has the molecular formula C20H15N5O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 5-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17011425 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 5-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H15N5O4S/c26-19(17-13-18(29-24-17)14-5-2-1-3-6-14)23-15-7-9-16(10-8-15)30(27,28)25-20-21-11-4-12-22-20/h1-13H,(H,23,26)(H,21,22,25) |
| InChIKey | NAODWDKOGKOQEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |