C19H15ClN3O2+ — CID 142893426
(4-chlorophenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium (PubChem CID 142893426) has the molecular formula C19H15ClN3O2+ and a molecular weight of 352.80 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium.
| Compound Name | (4-chlorophenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium |
|---|---|
| PubChem CID | 142893426 |
| Molecular Formula | C19H15ClN3O2+ |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (4-chlorophenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium |
| SMILES | O=C1COc2ccc(-c3ccnc([NH2+]c4ccc(Cl)cc4)c3)cc2N1 |
| InChI | InChI=1S/C19H14ClN3O2/c20-14-2-4-15(5-3-14)22-18-10-13(7-8-21-18)12-1-6-17-16(9-12)23-19(24)11-25-17/h1-10H,11H2,(H,21,22)(H,23,24)/p+1 |
| InChIKey | WLMKVCBREMXVKM-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|