C21H20N3O2+ — CID 142893545
(3,5-dimethylphenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium (PubChem CID 142893545) has the molecular formula C21H20N3O2+ and a molecular weight of 346.41 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium.
| Compound Name | (3,5-dimethylphenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium |
|---|---|
| PubChem CID | 142893545 |
| Molecular Formula | C21H20N3O2+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3,5-dimethylphenyl)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-pyridinyl]azanium |
| SMILES | Cc1cc(C)cc([NH2+]c2cc(-c3ccc4c(c3)NC(=O)CO4)ccn2)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-13-7-14(2)9-17(8-13)23-20-11-16(5-6-22-20)15-3-4-19-18(10-15)24-21(25)12-26-19/h3-11H,12H2,1-2H3,(H,22,23)(H,24,25)/p+1 |
| InChIKey | FEGKJLZRDDLEGQ-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|