2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid

C8H6N2O4 — CID 71463966

IUPAC2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid
SMILESO=C1COc2nc(C(=O)O)ccc2N1
InChIInChI=1S/C8H6N2O4/c11-6-3-14-7-4(9-6)1-2-5(10-7)8(12)13/h1-2H,3H2,(H,9,11)(H,12,13)
InChIKeyBVONTIDLPFVSGH-UHFFFAOYSA-N
MW194.15 g/mol
LogP0.11
Rot. Bonds1

About 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid

2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid (PubChem CID 71463966) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid.

Molecular Properties

Compound Name2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid
PubChem CID71463966
Molecular FormulaC8H6N2O4
Molecular Weight194.15 g/mol
Exact Mass194.03
IUPAC Name2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid
SMILESO=C1COc2nc(C(=O)O)ccc2N1
InChIInChI=1S/C8H6N2O4/c11-6-3-14-7-4(9-6)1-2-5(10-7)8(12)13/h1-2H,3H2,(H,9,11)(H,12,13)
InChIKeyBVONTIDLPFVSGH-UHFFFAOYSA-N
XLogP0.11
TPSA88.52 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.15
LogP ≤ 50.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid?
The IUPAC name of 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid (CID 71463966) is 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid.
What is the SMILES notation for 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid?
The canonical SMILES for 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid is O=C1COc2nc(C(=O)O)ccc2N1.
What is the InChIKey of 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid?
The InChIKey is BVONTIDLPFVSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O4/c11-6-3-14-7-4(9-6)1-2-5(10-7)8(12)13/h1-2H,3H2,(H,9,11)(H,12,13).
What are the key properties of 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid?
2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid has a molecular weight of 194.15 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid is sourced from PubChem (CID 71463966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).