C8H5N3O4 — CID 143404652
N,3-dioxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxamide (PubChem CID 143404652) has the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. Its IUPAC name is N,3-dioxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxamide.
| Compound Name | N,3-dioxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 143404652 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | N,3-dioxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxamide |
| SMILES | O=NC(=O)c1ccc2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C8H5N3O4/c12-6-3-15-5-2-1-4(8(13)11-14)9-7(5)10-6/h1-2H,3H2,(H,9,10,12) |
| InChIKey | HFGMQHYBPBZNFW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |