C13H9ClN2O2 — CID 117001049
6-(2-chlorophenyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 117001049) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-(2-chlorophenyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 117001049 |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 6-(2-chlorophenyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ccc(-c3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C13H9ClN2O2/c14-9-4-2-1-3-8(9)10-5-6-11-13(15-10)16-12(17)7-18-11/h1-6H,7H2,(H,15,16,17) |
| InChIKey | GZTQGDQHDGJHTI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |