C9H8N2O2 — CID 118798842
6-ethenyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 118798842) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 6-ethenyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-ethenyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 118798842 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 6-ethenyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | C=Cc1ccc2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C9H8N2O2/c1-2-6-3-4-7-9(10-6)11-8(12)5-13-7/h2-4H,1,5H2,(H,10,11,12) |
| InChIKey | JIHLPTSYTFXIBB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |