C11H8N2O2S — CID 155176000
7-sulfanyl-4H-[1,4]oxazino[3,2-b]quinolin-3-one (PubChem CID 155176000) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 7-sulfanyl-4H-[1,4]oxazino[3,2-b]quinolin-3-one.
| Compound Name | 7-sulfanyl-4H-[1,4]oxazino[3,2-b]quinolin-3-one |
|---|---|
| PubChem CID | 155176000 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 7-sulfanyl-4H-[1,4]oxazino[3,2-b]quinolin-3-one |
| SMILES | O=C1COc2cc3ccc(S)cc3nc2N1 |
| InChI | InChI=1S/C11H8N2O2S/c14-10-5-15-9-3-6-1-2-7(16)4-8(6)12-11(9)13-10/h1-4,16H,5H2,(H,12,13,14) |
| InChIKey | OIHIQVFXTOWAFM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|