C8H6N2O3 — CID 118380684
3-oxo-4H-pyrido[3,2-b][1,4]oxazine-7-carbaldehyde (PubChem CID 118380684) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-7-carbaldehyde.
| Compound Name | 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-7-carbaldehyde |
|---|---|
| PubChem CID | 118380684 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-7-carbaldehyde |
| SMILES | O=Cc1cnc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C8H6N2O3/c11-3-5-1-6-8(9-2-5)10-7(12)4-13-6/h1-3H,4H2,(H,9,10,12) |
| InChIKey | CHBQXFYUXNQJGC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|