C8H8BNO4 — CID 57415809
(3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid (PubChem CID 57415809) has the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. Its IUPAC name is (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid.
| Compound Name | (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid |
|---|---|
| PubChem CID | 57415809 |
| Molecular Formula | C8H8BNO4 |
| Molecular Weight | 192.97 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid |
| SMILES | O=C1COc2ccc(B(O)O)cc2N1 |
| InChI | InChI=1S/C8H8BNO4/c11-8-4-14-7-2-1-5(9(12)13)3-6(7)10-8/h1-3,12-13H,4H2,(H,10,11) |
| InChIKey | UWJIVYCLHMPFPZ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.97 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|