C18H15NO2 — CID 165122765
4H-1,4-benzoxazin-3-one;naphthalene (PubChem CID 165122765) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4H-1,4-benzoxazin-3-one;naphthalene.
| Compound Name | 4H-1,4-benzoxazin-3-one;naphthalene |
|---|---|
| PubChem CID | 165122765 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4H-1,4-benzoxazin-3-one;naphthalene |
| SMILES | O=C1COc2ccccc2N1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H7NO2/c1-2-6-10-8-4-3-7-9(10)5-1;10-8-5-11-7-4-2-1-3-6(7)9-8/h1-8H;1-4H,5H2,(H,9,10) |
| InChIKey | BREQPPLKNVFNKP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |