C35H34N2O8 — CID 177419199
(35Z)-2,12,16,26,33,38-hexaoxa-5,23-diazapentacyclo[37.4.0.06,11.017,22.027,32]tritetraconta-1(43),6,8,10,17,19,21,27,29,31,35,39,41-tridecaene-4,24-dione (PubChem CID 177419199) has the molecular formula C35H34N2O8 and a molecular weight of 610.66 g/mol. Its IUPAC name is (35Z)-2,12,16,26,33,38-hexaoxa-5,23-diazapentacyclo[37.4.0.06,11.017,22.027,32]tritetraconta-1(43),6,8,10,17,19,21,27,29,31,35,39,41-tridecaene-4,24-dione.
| Compound Name | (35Z)-2,12,16,26,33,38-hexaoxa-5,23-diazapentacyclo[37.4.0.06,11.017,22.027,32]tritetraconta-1(43),6,8,10,17,19,21,27,29,31,35,39,41-tridecaene-4,24-dione |
|---|---|
| PubChem CID | 177419199 |
| Molecular Formula | C35H34N2O8 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | (35Z)-2,12,16,26,33,38-hexaoxa-5,23-diazapentacyclo[37.4.0.06,11.017,22.027,32]tritetraconta-1(43),6,8,10,17,19,21,27,29,31,35,39,41-tridecaene-4,24-dione |
| SMILES | O=C1COc2ccccc2OC/C=C\COc2ccccc2OCC(=O)Nc2ccccc2OCCCOc2ccccc2N1 |
| InChI | InChI=1S/C35H34N2O8/c38-34-24-44-32-18-7-5-16-30(32)42-20-9-10-21-43-31-17-6-8-19-33(31)45-25-35(39)37-27-13-2-4-15-29(27)41-23-11-22-40-28-14-3-1-12-26(28)36-34/h1-10,12-19H,11,20-25H2,(H,36,38)(H,37,39)/b10-9- |
| InChIKey | AJWPWXZDKGZUFY-KTKRTIGZSA-N |
| XLogP | 5.90 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|