C21H22N2O4 — CID 177446883
(4E)-2,7-dioxa-15,19-diazatricyclo[19.4.0.08,13]pentacosa-1(25),4,8,10,12,21,23-heptaene-14,20-dione (PubChem CID 177446883) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (4E)-2,7-dioxa-15,19-diazatricyclo[19.4.0.08,13]pentacosa-1(25),4,8,10,12,21,23-heptaene-14,20-dione.
| Compound Name | (4E)-2,7-dioxa-15,19-diazatricyclo[19.4.0.08,13]pentacosa-1(25),4,8,10,12,21,23-heptaene-14,20-dione |
|---|---|
| PubChem CID | 177446883 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (4E)-2,7-dioxa-15,19-diazatricyclo[19.4.0.08,13]pentacosa-1(25),4,8,10,12,21,23-heptaene-14,20-dione |
| SMILES | O=C1NCCCNC(=O)c2ccccc2OC/C=C/COc2ccccc21 |
| InChI | InChI=1S/C21H22N2O4/c24-20-16-8-1-3-10-18(16)26-14-5-6-15-27-19-11-4-2-9-17(19)21(25)23-13-7-12-22-20/h1-6,8-11H,7,12-15H2,(H,22,24)(H,23,25)/b6-5+ |
| InChIKey | HYJOLSSVOFJQTE-AATRIKPKSA-N |
| XLogP | 2.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|