C10H11NO — CID 11240655
2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 11240655) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 11240655 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | O=C1NCCCc2ccccc21 |
| InChI | InChI=1S/C10H11NO/c12-10-9-6-2-1-4-8(9)5-3-7-11-10/h1-2,4,6H,3,5,7H2,(H,11,12) |
| InChIKey | WWQPGNZHJFFKRW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |