C21H31N3O3 — CID 167805516
(4Z)-18-methyl-2-oxa-7,11,18-triazabicyclo[18.4.0]tetracosa-1(24),4,20,22-tetraene-10,19-dione (PubChem CID 167805516) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (4Z)-18-methyl-2-oxa-7,11,18-triazabicyclo[18.4.0]tetracosa-1(24),4,20,22-tetraene-10,19-dione.
| Compound Name | (4Z)-18-methyl-2-oxa-7,11,18-triazabicyclo[18.4.0]tetracosa-1(24),4,20,22-tetraene-10,19-dione |
|---|---|
| PubChem CID | 167805516 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (4Z)-18-methyl-2-oxa-7,11,18-triazabicyclo[18.4.0]tetracosa-1(24),4,20,22-tetraene-10,19-dione |
| SMILES | CN1CCCCCCNC(=O)CCNC/C=C\COc2ccccc2C1=O |
| InChI | InChI=1S/C21H31N3O3/c1-24-16-8-3-2-6-14-23-20(25)12-15-22-13-7-9-17-27-19-11-5-4-10-18(19)21(24)26/h4-5,7,9-11,22H,2-3,6,8,12-17H2,1H3,(H,23,25)/b9-7- |
| InChIKey | ASCAZIQJOVLQLS-CLFYSBASSA-N |
| XLogP | 2.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|