C16H14O2 — CID 174046531
8,13-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,10,14,16-heptaene (PubChem CID 174046531) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 8,13-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,10,14,16-heptaene.
| Compound Name | 8,13-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,10,14,16-heptaene |
|---|---|
| PubChem CID | 174046531 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 8,13-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,10,14,16-heptaene |
| SMILES | C1=CCOc2ccccc2-c2ccccc2OC1 |
| InChI | InChI=1S/C16H14O2/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)18-12-6-5-11-17-15/h1-10H,11-12H2 |
| InChIKey | JVPALORZJXTBDD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|