C20H18O5 — CID 24828675
(12E)-2,10,15-trioxatricyclo[17.4.0.04,9]tricosa-1(23),4,6,8,12,19,21-heptaene-3,16-dione (PubChem CID 24828675) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (12E)-2,10,15-trioxatricyclo[17.4.0.04,9]tricosa-1(23),4,6,8,12,19,21-heptaene-3,16-dione.
| Compound Name | (12E)-2,10,15-trioxatricyclo[17.4.0.04,9]tricosa-1(23),4,6,8,12,19,21-heptaene-3,16-dione |
|---|---|
| PubChem CID | 24828675 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (12E)-2,10,15-trioxatricyclo[17.4.0.04,9]tricosa-1(23),4,6,8,12,19,21-heptaene-3,16-dione |
| SMILES | O=C1CCc2ccccc2OC(=O)c2ccccc2OC/C=C/CO1 |
| InChI | InChI=1S/C20H18O5/c21-19-12-11-15-7-1-3-9-17(15)25-20(22)16-8-2-4-10-18(16)23-13-5-6-14-24-19/h1-10H,11-14H2/b6-5+ |
| InChIKey | PMROOUSYBLLEEM-AATRIKPKSA-N |
| XLogP | 3.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|