About 3H-1-benzofuran-2-one;phosphorous acid
3H-1-benzofuran-2-one;phosphorous acid (PubChem CID 161350819) has the molecular formula C8H9O5P
and a molecular weight of 216.13 g/mol. Its IUPAC name is 3H-1-benzofuran-2-one;phosphorous acid.
Molecular Properties
| Compound Name | 3H-1-benzofuran-2-one;phosphorous acid |
| PubChem CID | 161350819 |
| Molecular Formula | C8H9O5P |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3H-1-benzofuran-2-one;phosphorous acid |
| SMILES | O=C1Cc2ccccc2O1.OP(O)O |
| InChI | InChI=1S/C8H6O2.H3O3P/c9-8-5-6-3-1-2-4-7(6)10-8;1-4(2)3/h1-4H,5H2;1-3H |
| InChIKey | VNXBYOWAYCPXMF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3H-1-benzofuran-2-one;phosphorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1-benzofuran-2-one;phosphorous acid?
The IUPAC name of 3H-1-benzofuran-2-one;phosphorous acid (CID 161350819) is 3H-1-benzofuran-2-one;phosphorous acid.
What is the SMILES notation for 3H-1-benzofuran-2-one;phosphorous acid?
The canonical SMILES for 3H-1-benzofuran-2-one;phosphorous acid is O=C1Cc2ccccc2O1.OP(O)O.
What is the InChIKey of 3H-1-benzofuran-2-one;phosphorous acid?
The InChIKey is VNXBYOWAYCPXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.H3O3P/c9-8-5-6-3-1-2-4-7(6)10-8;1-4(2)3/h1-4H,5H2;1-3H.
What are the key properties of 3H-1-benzofuran-2-one;phosphorous acid?
3H-1-benzofuran-2-one;phosphorous acid has a molecular weight of 216.13 g/mol, XLogP of 0.34, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1-benzofuran-2-one;phosphorous acid is sourced from PubChem (CID 161350819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).