About 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid
3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid (PubChem CID 159563483) has the molecular formula C16H14O5
and a molecular weight of 286.28 g/mol. Its IUPAC name is 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid |
| PubChem CID | 159563483 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)Cc1ccccc1O.O=C1Cc2ccccc2O1 |
| InChI | InChI=1S/C8H8O3.C8H6O2/c9-7-4-2-1-3-6(7)5-8(10)11;9-8-5-6-3-1-2-4-7(6)10-8/h1-4,9H,5H2,(H,10,11);1-4H,5H2 |
| InChIKey | MGXLFNOMASFQLB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid?
The IUPAC name of 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid (CID 159563483) is 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid.
What is the SMILES notation for 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid?
The canonical SMILES for 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid is O=C(O)Cc1ccccc1O.O=C1Cc2ccccc2O1.
What is the InChIKey of 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid?
The InChIKey is MGXLFNOMASFQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C8H6O2/c9-7-4-2-1-3-6(7)5-8(10)11;9-8-5-6-3-1-2-4-7(6)10-8/h1-4,9H,5H2,(H,10,11);1-4H,5H2.
What are the key properties of 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid?
3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid has a molecular weight of 286.28 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1-benzofuran-2-one;2-(2-hydroxyphenyl)acetic acid is sourced from PubChem (CID 159563483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).