About 4,9-dihydroxanthen-3-one
4,9-dihydroxanthen-3-one (PubChem CID 57451334) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4,9-dihydroxanthen-3-one.
Molecular Properties
| Compound Name | 4,9-dihydroxanthen-3-one |
| PubChem CID | 57451334 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 4,9-dihydroxanthen-3-one |
| SMILES | O=C1C=CC2=C(C1)Oc1ccccc1C2 |
| InChI | InChI=1S/C13H10O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-6H,7-8H2 |
| InChIKey | VAOFWTJOTLRGBI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,9-dihydroxanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dihydroxanthen-3-one?
The IUPAC name of 4,9-dihydroxanthen-3-one (CID 57451334) is 4,9-dihydroxanthen-3-one.
What is the SMILES notation for 4,9-dihydroxanthen-3-one?
The canonical SMILES for 4,9-dihydroxanthen-3-one is O=C1C=CC2=C(C1)Oc1ccccc1C2.
What is the InChIKey of 4,9-dihydroxanthen-3-one?
The InChIKey is VAOFWTJOTLRGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-6H,7-8H2.
What are the key properties of 4,9-dihydroxanthen-3-one?
4,9-dihydroxanthen-3-one has a molecular weight of 198.22 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dihydroxanthen-3-one is sourced from PubChem (CID 57451334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).