About 4,9-dihydro-1H-xanthene
4,9-dihydro-1H-xanthene (PubChem CID 15851343) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 4,9-dihydro-1H-xanthene.
Molecular Properties
| Compound Name | 4,9-dihydro-1H-xanthene |
| PubChem CID | 15851343 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 4,9-dihydro-1H-xanthene |
| SMILES | C1=CCC2=C(C1)Cc1ccccc1O2 |
| InChI | InChI=1S/C13H12O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-5,7H,6,8-9H2 |
| InChIKey | JQWBQDCYIGMYKF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dihydro-1H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dihydro-1H-xanthene?
The IUPAC name of 4,9-dihydro-1H-xanthene (CID 15851343) is 4,9-dihydro-1H-xanthene.
What is the SMILES notation for 4,9-dihydro-1H-xanthene?
The canonical SMILES for 4,9-dihydro-1H-xanthene is C1=CCC2=C(C1)Cc1ccccc1O2.
What is the InChIKey of 4,9-dihydro-1H-xanthene?
The InChIKey is JQWBQDCYIGMYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-5,7H,6,8-9H2.
What are the key properties of 4,9-dihydro-1H-xanthene?
4,9-dihydro-1H-xanthene has a molecular weight of 184.24 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dihydro-1H-xanthene is sourced from PubChem (CID 15851343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).