About anthracene;9H-xanthene
anthracene;9H-xanthene (PubChem CID 141402821) has the molecular formula C27H20O
and a molecular weight of 360.46 g/mol. Its IUPAC name is anthracene;9H-xanthene.
Molecular Properties
| Compound Name | anthracene;9H-xanthene |
| PubChem CID | 141402821 |
| Molecular Formula | C27H20O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | anthracene;9H-xanthene |
| SMILES | c1ccc2c(c1)Cc1ccccc1O2.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C13H10O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-10H;1-8H,9H2 |
| InChIKey | QMQBVAIUKTZYDE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;9H-xanthene?
The IUPAC name of anthracene;9H-xanthene (CID 141402821) is anthracene;9H-xanthene.
What is the SMILES notation for anthracene;9H-xanthene?
The canonical SMILES for anthracene;9H-xanthene is c1ccc2c(c1)Cc1ccccc1O2.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;9H-xanthene?
The InChIKey is QMQBVAIUKTZYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C13H10O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-10H;1-8H,9H2.
What are the key properties of anthracene;9H-xanthene?
anthracene;9H-xanthene has a molecular weight of 360.46 g/mol, XLogP of 7.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;9H-xanthene is sourced from PubChem (CID 141402821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).