About ethane;4H-pyran;9H-xanthene
ethane;4H-pyran;9H-xanthene (PubChem CID 159470126) has the molecular formula C24H34O2
and a molecular weight of 354.53 g/mol. Its IUPAC name is ethane;4H-pyran;9H-xanthene.
Molecular Properties
| Compound Name | ethane;4H-pyran;9H-xanthene |
| PubChem CID | 159470126 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ethane;4H-pyran;9H-xanthene |
| SMILES | C1=COC=CC1.CC.CC.CC.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C13H10O.C5H6O.3C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-4-6-5-3-1;3*1-2/h1-8H,9H2;2-5H,1H2;3*1-2H3 |
| InChIKey | LVRSGLGIOUPIFL-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4H-pyran;9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4H-pyran;9H-xanthene?
The IUPAC name of ethane;4H-pyran;9H-xanthene (CID 159470126) is ethane;4H-pyran;9H-xanthene.
What is the SMILES notation for ethane;4H-pyran;9H-xanthene?
The canonical SMILES for ethane;4H-pyran;9H-xanthene is C1=COC=CC1.CC.CC.CC.c1ccc2c(c1)Cc1ccccc1O2.
What is the InChIKey of ethane;4H-pyran;9H-xanthene?
The InChIKey is LVRSGLGIOUPIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C5H6O.3C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-4-6-5-3-1;3*1-2/h1-8H,9H2;2-5H,1H2;3*1-2H3.
What are the key properties of ethane;4H-pyran;9H-xanthene?
ethane;4H-pyran;9H-xanthene has a molecular weight of 354.53 g/mol, XLogP of 7.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4H-pyran;9H-xanthene is sourced from PubChem (CID 159470126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).