C18H18O2 — CID 15416999
(13E)-2,5-dioxatricyclo[14.4.0.06,11]icosa-1(20),6,8,10,13,16,18-heptaene (PubChem CID 15416999) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (13E)-2,5-dioxatricyclo[14.4.0.06,11]icosa-1(20),6,8,10,13,16,18-heptaene.
| Compound Name | (13E)-2,5-dioxatricyclo[14.4.0.06,11]icosa-1(20),6,8,10,13,16,18-heptaene |
|---|---|
| PubChem CID | 15416999 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (13E)-2,5-dioxatricyclo[14.4.0.06,11]icosa-1(20),6,8,10,13,16,18-heptaene |
| SMILES | C1=C/Cc2ccccc2OCCOc2ccccc2C/1 |
| InChI | InChI=1S/C18H18O2/c1-2-8-16-10-4-6-12-18(16)20-14-13-19-17-11-5-3-9-15(17)7-1/h1-6,9-12H,7-8,13-14H2/b2-1+ |
| InChIKey | PNZNXZYSTQYFBV-OWOJBTEDSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|