About 4H-chromene;manganese
4H-chromene;manganese (PubChem CID 67107670) has the molecular formula C9H8MnO
and a molecular weight of 187.10 g/mol. Its IUPAC name is 4H-chromene;manganese.
Molecular Properties
| Compound Name | 4H-chromene;manganese |
| PubChem CID | 67107670 |
| Molecular Formula | C9H8MnO |
| Molecular Weight | 187.10 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 4H-chromene;manganese |
| SMILES | C1=COc2ccccc2C1.[Mn] |
| InChI | InChI=1S/C9H8O.Mn/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-4,6-7H,5H2; |
| InChIKey | MWXAWSWZIKKKGN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-chromene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-chromene;manganese?
The IUPAC name of 4H-chromene;manganese (CID 67107670) is 4H-chromene;manganese.
What is the SMILES notation for 4H-chromene;manganese?
The canonical SMILES for 4H-chromene;manganese is C1=COc2ccccc2C1.[Mn].
What is the InChIKey of 4H-chromene;manganese?
The InChIKey is MWXAWSWZIKKKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.Mn/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-4,6-7H,5H2;.
What are the key properties of 4H-chromene;manganese?
4H-chromene;manganese has a molecular weight of 187.10 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-chromene;manganese is sourced from PubChem (CID 67107670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).