C15H14O2 — CID 20671322
9,12-dioxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaene (PubChem CID 20671322) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 9,12-dioxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaene.
| Compound Name | 9,12-dioxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaene |
|---|---|
| PubChem CID | 20671322 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 9,12-dioxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaene |
| SMILES | c1ccc2c(c1)Cc1ccccc1OCCO2 |
| InChI | InChI=1S/C15H14O2/c1-3-7-14-12(5-1)11-13-6-2-4-8-15(13)17-10-9-16-14/h1-8H,9-11H2 |
| InChIKey | HUCSZFYCZJYSTC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |