C19H22O4 — CID 10087254
13,13,14,14-tetradeuterio-9,12,15,18-tetraoxatricyclo[17.4.0.03,8]tricosa-1(23),3,5,7,19,21-hexaene (PubChem CID 10087254) has the molecular formula C19H22O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 13,13,14,14-tetradeuterio-9,12,15,18-tetraoxatricyclo[17.4.0.03,8]tricosa-1(23),3,5,7,19,21-hexaene.
| Compound Name | 13,13,14,14-tetradeuterio-9,12,15,18-tetraoxatricyclo[17.4.0.03,8]tricosa-1(23),3,5,7,19,21-hexaene |
|---|---|
| PubChem CID | 10087254 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 13,13,14,14-tetradeuterio-9,12,15,18-tetraoxatricyclo[17.4.0.03,8]tricosa-1(23),3,5,7,19,21-hexaene |
| SMILES | [2H]C1([2H])OCCOc2ccccc2Cc2ccccc2OCCOC1([2H])[2H] |
| InChI | InChI=1S/C19H22O4/c1-3-7-18-16(5-1)15-17-6-2-4-8-19(17)23-14-12-21-10-9-20-11-13-22-18/h1-8H,9-15H2/i9D2,10D2 |
| InChIKey | ZEIAJHSIPKDAOG-YQUBHJMPSA-N |
| XLogP | 3.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |